C22H20ClN5O5S — CID 139960116
4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethylamino]-N-hydroxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 139960116) has the molecular formula C22H20ClN5O5S and a molecular weight of 501.95 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethylamino]-N-hydroxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethylamino]-N-hydroxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 139960116 |
| Molecular Formula | C22H20ClN5O5S |
| Molecular Weight | 501.95 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethylamino]-N-hydroxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cc1nn(C)c2ncc(C(=O)NO)c(NCS(=O)(=O)c3ccc(Oc4ccc(Cl)cc4)cc3)c12 |
| InChI | InChI=1S/C22H20ClN5O5S/c1-13-19-20(18(22(29)27-30)11-24-21(19)28(2)26-13)25-12-34(31,32)17-9-7-16(8-10-17)33-15-5-3-14(23)4-6-15/h3-11,30H,12H2,1-2H3,(H,24,25)(H,27,29) |
| InChIKey | YRPJXAMLRUDGNH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|