C26H24N2O5 — CID 173255406
4-hydroxyimino-2-(3-oxo-1H-isoindole-2-carbonyl)-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)butanoic acid (PubChem CID 173255406) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-hydroxyimino-2-(3-oxo-1H-isoindole-2-carbonyl)-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)butanoic acid.
| Compound Name | 4-hydroxyimino-2-(3-oxo-1H-isoindole-2-carbonyl)-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)butanoic acid |
|---|---|
| PubChem CID | 173255406 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-hydroxyimino-2-(3-oxo-1H-isoindole-2-carbonyl)-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)butanoic acid |
| SMILES | O=C(O)C(CC(=NO)c1ccc2c(c1)CC1=C2CCCC1)C(=O)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C26H24N2O5/c29-24-21-8-4-2-6-17(21)14-28(24)25(30)22(26(31)32)13-23(27-33)16-9-10-20-18(12-16)11-15-5-1-3-7-19(15)20/h2,4,6,8-10,12,22,33H,1,3,5,7,11,13-14H2,(H,31,32) |
| InChIKey | MYEPVDXGBLNVBV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|