C41H31NO6 — CID 11215828
4-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid (PubChem CID 11215828) has the molecular formula C41H31NO6 and a molecular weight of 633.70 g/mol. Its IUPAC name is 4-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11215828 |
| Molecular Formula | C41H31NO6 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 4-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid |
| SMILES | O=C(CC(CCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc(-c2ccc(-c3c(Cc4ccccc4)oc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C41H31NO6/c43-35(25-31(41(46)47)22-23-42-39(44)32-10-4-5-11-33(32)40(42)45)29-18-14-27(15-19-29)28-16-20-30(21-17-28)38-34-12-6-7-13-36(34)48-37(38)24-26-8-2-1-3-9-26/h1-21,31H,22-25H2,(H,46,47) |
| InChIKey | QNYLAIBEHNOPPA-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|