C31H24Br2O4 — CID 22462600
2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]-2,6-dibromophenoxy]butanoic acid (PubChem CID 22462600) has the molecular formula C31H24Br2O4 and a molecular weight of 620.34 g/mol. Its IUPAC name is 2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]-2,6-dibromophenoxy]butanoic acid.
| Compound Name | 2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]-2,6-dibromophenoxy]butanoic acid |
|---|---|
| PubChem CID | 22462600 |
| Molecular Formula | C31H24Br2O4 |
| Molecular Weight | 620.34 g/mol |
| Exact Mass | 618.00 |
| IUPAC Name | 2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]-2,6-dibromophenoxy]butanoic acid |
| SMILES | CCC(Oc1c(Br)cc(-c2ccc(-c3c(Cc4ccccc4)oc4ccccc34)cc2)cc1Br)C(=O)O |
| InChI | InChI=1S/C31H24Br2O4/c1-2-26(31(34)35)37-30-24(32)17-22(18-25(30)33)20-12-14-21(15-13-20)29-23-10-6-7-11-27(23)36-28(29)16-19-8-4-3-5-9-19/h3-15,17-18,26H,2,16H2,1H3,(H,34,35) |
| InChIKey | NQGDVVNWCILAEH-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.34 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |