C29H21FNO5S- — CID 69056652
2-benzyl-3-[4-[4-[carboxymethyl(sulfinato)amino]-3-fluorophenyl]phenyl]-1-benzofuran (PubChem CID 69056652) has the molecular formula C29H21FNO5S- and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-benzyl-3-[4-[4-[carboxymethyl(sulfinato)amino]-3-fluorophenyl]phenyl]-1-benzofuran.
| Compound Name | 2-benzyl-3-[4-[4-[carboxymethyl(sulfinato)amino]-3-fluorophenyl]phenyl]-1-benzofuran |
|---|---|
| PubChem CID | 69056652 |
| Molecular Formula | C29H21FNO5S- |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-benzyl-3-[4-[4-[carboxymethyl(sulfinato)amino]-3-fluorophenyl]phenyl]-1-benzofuran |
| SMILES | O=C(O)CN(c1ccc(-c2ccc(-c3c(Cc4ccccc4)oc4ccccc34)cc2)cc1F)S(=O)[O-] |
| InChI | InChI=1S/C29H22FNO5S/c30-24-17-22(14-15-25(24)31(37(34)35)18-28(32)33)20-10-12-21(13-11-20)29-23-8-4-5-9-26(23)36-27(29)16-19-6-2-1-3-7-19/h1-15,17H,16,18H2,(H,32,33)(H,34,35)/p-1 |
| InChIKey | SIVREEMOWCOKAD-UHFFFAOYSA-M |
| XLogP | 6.18 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|