C31H26O4 — CID 10600136
methyl (2R)-2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenoxy]propanoate (PubChem CID 10600136) has the molecular formula C31H26O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl (2R)-2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 10600136 |
| Molecular Formula | C31H26O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | methyl (2R)-2-[4-[4-(2-benzyl-1-benzofuran-3-yl)phenyl]phenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1ccc(-c2ccc(-c3c(Cc4ccccc4)oc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C31H26O4/c1-21(31(32)33-2)34-26-18-16-24(17-19-26)23-12-14-25(15-13-23)30-27-10-6-7-11-28(27)35-29(30)20-22-8-4-3-5-9-22/h3-19,21H,20H2,1-2H3/t21-/m1/s1 |
| InChIKey | INGCVIUCLUIHKY-OAQYLSRUSA-N |
| XLogP | 7.30 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |