C27H25ClO5 — CID 70097340
2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-6-(2-methoxyphenyl)-6-oxohexanoic acid (PubChem CID 70097340) has the molecular formula C27H25ClO5 and a molecular weight of 464.95 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-6-(2-methoxyphenyl)-6-oxohexanoic acid.
| Compound Name | 2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-6-(2-methoxyphenyl)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 70097340 |
| Molecular Formula | C27H25ClO5 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-6-(2-methoxyphenyl)-6-oxohexanoic acid |
| SMILES | COc1ccccc1C(=O)CCCC(CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H25ClO5/c1-33-26-8-3-2-6-23(26)24(29)7-4-5-21(27(31)32)17-25(30)20-11-9-18(10-12-20)19-13-15-22(28)16-14-19/h2-3,6,8-16,21H,4-5,7,17H2,1H3,(H,31,32) |
| InChIKey | QMDCCIRTBHYDPD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |