C19H20O5 — CID 11738943
(2R)-2-hydroxy-1,5-bis(2-methoxyphenyl)pentane-1,5-dione (PubChem CID 11738943) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2R)-2-hydroxy-1,5-bis(2-methoxyphenyl)pentane-1,5-dione.
| Compound Name | (2R)-2-hydroxy-1,5-bis(2-methoxyphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 11738943 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R)-2-hydroxy-1,5-bis(2-methoxyphenyl)pentane-1,5-dione |
| SMILES | COc1ccccc1C(=O)CC[C@@H](O)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C19H20O5/c1-23-17-9-5-3-7-13(17)15(20)11-12-16(21)19(22)14-8-4-6-10-18(14)24-2/h3-10,16,21H,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | KWYWCPCDFZYVPA-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |