C13H16O4 — CID 101179657
(2R)-2-hydroxy-1-(2-methoxyphenyl)hexane-1,5-dione (PubChem CID 101179657) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-(2-methoxyphenyl)hexane-1,5-dione.
| Compound Name | (2R)-2-hydroxy-1-(2-methoxyphenyl)hexane-1,5-dione |
|---|---|
| PubChem CID | 101179657 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (2R)-2-hydroxy-1-(2-methoxyphenyl)hexane-1,5-dione |
| SMILES | COc1ccccc1C(=O)[C@H](O)CCC(C)=O |
| InChI | InChI=1S/C13H16O4/c1-9(14)7-8-11(15)13(16)10-5-3-4-6-12(10)17-2/h3-6,11,15H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | VRUVNYOQJMZISV-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |