C14H18O4 — CID 101235095
(2R)-2-hydroxy-1-(2-methoxyphenyl)-2-methylhexane-1,5-dione (PubChem CID 101235095) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-(2-methoxyphenyl)-2-methylhexane-1,5-dione.
| Compound Name | (2R)-2-hydroxy-1-(2-methoxyphenyl)-2-methylhexane-1,5-dione |
|---|---|
| PubChem CID | 101235095 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2R)-2-hydroxy-1-(2-methoxyphenyl)-2-methylhexane-1,5-dione |
| SMILES | COc1ccccc1C(=O)[C@](C)(O)CCC(C)=O |
| InChI | InChI=1S/C14H18O4/c1-10(15)8-9-14(2,17)13(16)11-6-4-5-7-12(11)18-3/h4-7,17H,8-9H2,1-3H3/t14-/m1/s1 |
| InChIKey | NDOZTCBXQKSSKF-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |