C10H7Br2NO2 — CID 23039923
2,2-dibromo-3-(2-methoxyphenyl)-3-oxopropanenitrile (PubChem CID 23039923) has the molecular formula C10H7Br2NO2 and a molecular weight of 332.98 g/mol. Its IUPAC name is 2,2-dibromo-3-(2-methoxyphenyl)-3-oxopropanenitrile.
| Compound Name | 2,2-dibromo-3-(2-methoxyphenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 23039923 |
| Molecular Formula | C10H7Br2NO2 |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.88 |
| IUPAC Name | 2,2-dibromo-3-(2-methoxyphenyl)-3-oxopropanenitrile |
| SMILES | COc1ccccc1C(=O)C(Br)(Br)C#N |
| InChI | InChI=1S/C10H7Br2NO2/c1-15-8-5-3-2-4-7(8)9(14)10(11,12)6-13/h2-5H,1H3 |
| InChIKey | BLNPXWDXGBIVMB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|