C29H30ClNO5 — CID 18978930
4-[4-(4-chlorophenyl)phenyl]-2-[2-[2-(2-ethoxyethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid (PubChem CID 18978930) has the molecular formula C29H30ClNO5 and a molecular weight of 508.01 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)phenyl]-2-[2-[2-(2-ethoxyethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[2-(2-ethoxyethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18978930 |
| Molecular Formula | C29H30ClNO5 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[2-(2-ethoxyethylcarbamoyl)phenyl]ethyl]-4-oxobutanoic acid |
| SMILES | CCOCCNC(=O)c1ccccc1CCC(CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H30ClNO5/c1-2-36-18-17-31-28(33)26-6-4-3-5-22(26)9-12-24(29(34)35)19-27(32)23-10-7-20(8-11-23)21-13-15-25(30)16-14-21/h3-8,10-11,13-16,24H,2,9,12,17-19H2,1H3,(H,31,33)(H,34,35) |
| InChIKey | IAIGKFXVSFDZKU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|