C26H22ClN3O4 — CID 59331989
2-[2-[(4-chlorophenyl)-[4-(1H-pyrazol-4-yl)phenyl]methoxy]ethylcarbamoyl]benzoic acid (PubChem CID 59331989) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)-[4-(1H-pyrazol-4-yl)phenyl]methoxy]ethylcarbamoyl]benzoic acid.
| Compound Name | 2-[2-[(4-chlorophenyl)-[4-(1H-pyrazol-4-yl)phenyl]methoxy]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59331989 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)-[4-(1H-pyrazol-4-yl)phenyl]methoxy]ethylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCCOC(c1ccc(Cl)cc1)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C26H22ClN3O4/c27-21-11-9-19(10-12-21)24(18-7-5-17(6-8-18)20-15-29-30-16-20)34-14-13-28-25(31)22-3-1-2-4-23(22)26(32)33/h1-12,15-16,24H,13-14H2,(H,28,31)(H,29,30)(H,32,33) |
| InChIKey | PUTLTXAPUHYIIH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|