C25H23ClO3 — CID 70063150
(2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-3-phenylpentanoic acid (PubChem CID 70063150) has the molecular formula C25H23ClO3 and a molecular weight of 406.91 g/mol. Its IUPAC name is (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-3-phenylpentanoic acid.
| Compound Name | (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 70063150 |
| Molecular Formula | C25H23ClO3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-3-phenylpentanoic acid |
| SMILES | CCC(c1ccccc1)[C@H](CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H23ClO3/c1-2-22(19-6-4-3-5-7-19)23(25(28)29)16-24(27)20-10-8-17(9-11-20)18-12-14-21(26)15-13-18/h3-15,22-23H,2,16H2,1H3,(H,28,29)/t22?,23-/m0/s1 |
| InChIKey | AKUODBBRKYAMLG-WCSIJFPASA-N |
| XLogP | 6.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |