C23H19ClO5S — CID 54327915
(2S)-2-(benzenesulfonylmethyl)-4-[4-(4-chlorophenyl)phenyl]-4-oxobutanoic acid (PubChem CID 54327915) has the molecular formula C23H19ClO5S and a molecular weight of 442.92 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonylmethyl)-4-[4-(4-chlorophenyl)phenyl]-4-oxobutanoic acid.
| Compound Name | (2S)-2-(benzenesulfonylmethyl)-4-[4-(4-chlorophenyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54327915 |
| Molecular Formula | C23H19ClO5S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (2S)-2-(benzenesulfonylmethyl)-4-[4-(4-chlorophenyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](CS(=O)(=O)c1ccccc1)C(=O)O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19ClO5S/c24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)22(25)14-19(23(26)27)15-30(28,29)21-4-2-1-3-5-21/h1-13,19H,14-15H2,(H,26,27)/t19-/m1/s1 |
| InChIKey | SWGKWDQDTMOWNO-LJQANCHMSA-N |
| XLogP | 4.75 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |