C23H17ClO5S — CID 134485249
(2S)-4-[4-(4-chlorophenyl)phenyl]-4-oxo-2-phenylsulfanylcarbonyloxybutanoic acid (PubChem CID 134485249) has the molecular formula C23H17ClO5S and a molecular weight of 440.90 g/mol. Its IUPAC name is (2S)-4-[4-(4-chlorophenyl)phenyl]-4-oxo-2-phenylsulfanylcarbonyloxybutanoic acid.
| Compound Name | (2S)-4-[4-(4-chlorophenyl)phenyl]-4-oxo-2-phenylsulfanylcarbonyloxybutanoic acid |
|---|---|
| PubChem CID | 134485249 |
| Molecular Formula | C23H17ClO5S |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (2S)-4-[4-(4-chlorophenyl)phenyl]-4-oxo-2-phenylsulfanylcarbonyloxybutanoic acid |
| SMILES | O=C(O[C@@H](CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O)Sc1ccccc1 |
| InChI | InChI=1S/C23H17ClO5S/c24-18-12-10-16(11-13-18)15-6-8-17(9-7-15)20(25)14-21(22(26)27)29-23(28)30-19-4-2-1-3-5-19/h1-13,21H,14H2,(H,26,27)/t21-/m0/s1 |
| InChIKey | DAUPMHNKAYXZDO-NRFANRHFSA-N |
| XLogP | 5.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|