C16H12N2O5 — CID 89159437
4-(5-nitroso-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid (PubChem CID 89159437) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 4-(5-nitroso-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid.
| Compound Name | 4-(5-nitroso-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 89159437 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-(5-nitroso-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
| SMILES | O=Nc1cc2c3c(cccc3c1)C(=O)N(CCCC(=O)O)C2=O |
| InChI | InChI=1S/C16H12N2O5/c19-13(20)5-2-6-18-15(21)11-4-1-3-9-7-10(17-23)8-12(14(9)11)16(18)22/h1,3-4,7-8H,2,5-6H2,(H,19,20) |
| InChIKey | USKPFNKMIHSITA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|