C25H18N2O3S — CID 4749915
S-quinolin-8-yl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanethioate (PubChem CID 4749915) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is S-quinolin-8-yl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanethioate.
| Compound Name | S-quinolin-8-yl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanethioate |
|---|---|
| PubChem CID | 4749915 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | S-quinolin-8-yl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanethioate |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)Sc1cccc2cccnc12 |
| InChI | InChI=1S/C25H18N2O3S/c28-21(31-20-12-3-8-17-9-4-14-26-23(17)20)13-5-15-27-24(29)18-10-1-6-16-7-2-11-19(22(16)18)25(27)30/h1-4,6-12,14H,5,13,15H2 |
| InChIKey | LLZLTVQFXZJGCC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|