C15H14N2O3S — CID 46609312
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 1H-indole-3-carboxylate (PubChem CID 46609312) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 1H-indole-3-carboxylate.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 46609312 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)ethyl 1H-indole-3-carboxylate |
| SMILES | Cc1csc(=O)n1CCOC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H14N2O3S/c1-10-9-21-15(19)17(10)6-7-20-14(18)12-8-16-13-5-3-2-4-11(12)13/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | GVPBFPWKOZGSJM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |