C28H20N2O5 — CID 31512137
dibenzofuran-2-yl 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 31512137) has the molecular formula C28H20N2O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is dibenzofuran-2-yl 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | dibenzofuran-2-yl 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 31512137 |
| Molecular Formula | C28H20N2O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | dibenzofuran-2-yl 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Oc2ccc3oc4ccccc4c3c2)C1=O |
| InChI | InChI=1S/C28H20N2O5/c1-28(19-11-10-17-6-2-3-7-18(17)14-19)26(32)30(27(33)29-28)16-25(31)34-20-12-13-24-22(15-20)21-8-4-5-9-23(21)35-24/h2-15H,16H2,1H3,(H,29,33)/t28-/m1/s1 |
| InChIKey | CUIXFUBOIXAEMO-MUUNZHRXSA-N |
| XLogP | 5.11 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|