C19H17N3O4 — CID 7793306
[(1R)-1-cyanoethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793306) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [(1R)-1-cyanoethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793306 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C[C@H](C#N)OC(=O)CN1C(=O)N[C@@](C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C19H17N3O4/c1-12(10-20)26-16(23)11-22-17(24)19(2,21-18(22)25)15-8-7-13-5-3-4-6-14(13)9-15/h3-9,12H,11H2,1-2H3,(H,21,25)/t12-,19+/m1/s1 |
| InChIKey | YAGNHBRLQXNQRJ-BLVKFPJESA-N |
| XLogP | 2.06 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|