C19H32N2O2 — CID 111462643
1-[benzyl(methyl)amino]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol (PubChem CID 111462643) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 111462643 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol |
| SMILES | CCC(O)C1CCCCN1CC(O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H32N2O2/c1-3-19(23)18-11-7-8-12-21(18)15-17(22)14-20(2)13-16-9-5-4-6-10-16/h4-6,9-10,17-19,22-23H,3,7-8,11-15H2,1-2H3 |
| InChIKey | XEZMTTLFKZTMBZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |