C20H32N2O3 — CID 109397522
1-[benzyl(methyl)amino]-3-(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propan-2-ol (PubChem CID 109397522) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 109397522 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-(6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)propan-2-ol |
| SMILES | COC1CCC2OCCN(CC(O)CN(C)Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C20H32N2O3/c1-21(13-16-6-4-3-5-7-16)14-17(23)15-22-10-11-25-20-9-8-18(24-2)12-19(20)22/h3-7,17-20,23H,8-15H2,1-2H3 |
| InChIKey | SXTCKXOSERKVJP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |