C25H30N2O6 — CID 26011684
(5R)-5-ethyl-3-[(2S)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 26011684) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[(2S)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[(2S)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26011684 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (5R)-5-ethyl-3-[(2S)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | C=CCc1ccc(OC[C@@H](O)CN2C(=O)N[C@](CC)(c3ccc(OC)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-5-7-17-8-13-21(22(14-17)32-4)33-16-19(28)15-27-23(29)25(6-2,26-24(27)30)18-9-11-20(31-3)12-10-18/h5,8-14,19,28H,1,6-7,15-16H2,2-4H3,(H,26,30)/t19-,25+/m0/s1 |
| InChIKey | OVFXPSOEAXGVMH-UQBPGWFLSA-N |
| XLogP | 3.03 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|