C16H24NO3+ — CID 7830788
cyclopropyl-[(2R)-2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium (PubChem CID 7830788) has the molecular formula C16H24NO3+ and a molecular weight of 278.37 g/mol. Its IUPAC name is cyclopropyl-[(2R)-2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium.
| Compound Name | cyclopropyl-[(2R)-2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 7830788 |
| Molecular Formula | C16H24NO3+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | cyclopropyl-[(2R)-2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium |
| SMILES | C/C=C/c1ccc(OC[C@H](O)C[NH2+]C2CC2)c(OC)c1 |
| InChI | InChI=1S/C16H23NO3/c1-3-4-12-5-8-15(16(9-12)19-2)20-11-14(18)10-17-13-6-7-13/h3-5,8-9,13-14,17-18H,6-7,10-11H2,1-2H3/p+1/b4-3+/t14-/m1/s1 |
| InChIKey | VGVVAUJZAWKIOR-RDFMZFSFSA-O |
| XLogP | 1.19 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |