C23H31NO3 — CID 55703546
1-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-3-[methyl(3-phenylpropyl)amino]propan-2-ol (PubChem CID 55703546) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-3-[methyl(3-phenylpropyl)amino]propan-2-ol.
| Compound Name | 1-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-3-[methyl(3-phenylpropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 55703546 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-3-[methyl(3-phenylpropyl)amino]propan-2-ol |
| SMILES | C/C=C/c1ccc(OCC(O)CN(C)CCCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H31NO3/c1-4-9-20-13-14-22(23(16-20)26-3)27-18-21(25)17-24(2)15-8-12-19-10-6-5-7-11-19/h4-7,9-11,13-14,16,21,25H,8,12,15,17-18H2,1-3H3/b9-4+ |
| InChIKey | BAUVJGCRPQDNMX-RUDMXATFSA-N |
| XLogP | 4.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |