C22H28FNO4 — CID 55436564
1-[2-(2-fluorophenoxy)ethyl-methylamino]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol (PubChem CID 55436564) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethyl-methylamino]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(2-fluorophenoxy)ethyl-methylamino]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 55436564 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethyl-methylamino]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol |
| SMILES | CC=Cc1ccc(OCC(O)CN(C)CCOc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C22H28FNO4/c1-4-7-17-10-11-21(22(14-17)26-3)28-16-18(25)15-24(2)12-13-27-20-9-6-5-8-19(20)23/h4-11,14,18,25H,12-13,15-16H2,1-3H3 |
| InChIKey | IYMYCFHFODXLHN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |