C16H27NO4 — CID 78896461
1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-propan-2-yloxypropan-2-ol (PubChem CID 78896461) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 78896461 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-propan-2-yloxypropan-2-ol |
| SMILES | COc1ccccc1OCCN(C)CC(O)COC(C)C |
| InChI | InChI=1S/C16H27NO4/c1-13(2)21-12-14(18)11-17(3)9-10-20-16-8-6-5-7-15(16)19-4/h5-8,13-14,18H,9-12H2,1-4H3 |
| InChIKey | CZSCMTURXVBBNA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |