C14H23NO3 — CID 46986793
3-[2-(2-ethylphenoxy)ethyl-methylamino]propane-1,2-diol (PubChem CID 46986793) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-[2-(2-ethylphenoxy)ethyl-methylamino]propane-1,2-diol.
| Compound Name | 3-[2-(2-ethylphenoxy)ethyl-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 46986793 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-[2-(2-ethylphenoxy)ethyl-methylamino]propane-1,2-diol |
| SMILES | CCc1ccccc1OCCN(C)CC(O)CO |
| InChI | InChI=1S/C14H23NO3/c1-3-12-6-4-5-7-14(12)18-9-8-15(2)10-13(17)11-16/h4-7,13,16-17H,3,8-11H2,1-2H3 |
| InChIKey | MQZQKYPCCNYASW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |