C22H29NO7 — CID 110194005
3-[3-benzhydryloxypropyl(methyl)amino]propane-1,2-diol;oxalic acid (PubChem CID 110194005) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is 3-[3-benzhydryloxypropyl(methyl)amino]propane-1,2-diol;oxalic acid.
| Compound Name | 3-[3-benzhydryloxypropyl(methyl)amino]propane-1,2-diol;oxalic acid |
|---|---|
| PubChem CID | 110194005 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 3-[3-benzhydryloxypropyl(methyl)amino]propane-1,2-diol;oxalic acid |
| SMILES | CN(CCCOC(c1ccccc1)c1ccccc1)CC(O)CO.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H27NO3.C2H2O4/c1-21(15-19(23)16-22)13-8-14-24-20(17-9-4-2-5-10-17)18-11-6-3-7-12-18;3-1(4)2(5)6/h2-7,9-12,19-20,22-23H,8,13-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ICHFSTBSSVTKMS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|