C36H45ClN2O3 — CID 158709757
2-benzhydryloxy-N-(2-chloroethyl)-N-methylethanamine;2-[2-benzhydryloxyethyl(methyl)amino]ethanol (PubChem CID 158709757) has the molecular formula C36H45ClN2O3 and a molecular weight of 589.22 g/mol. Its IUPAC name is 2-benzhydryloxy-N-(2-chloroethyl)-N-methylethanamine;2-[2-benzhydryloxyethyl(methyl)amino]ethanol.
| Compound Name | 2-benzhydryloxy-N-(2-chloroethyl)-N-methylethanamine;2-[2-benzhydryloxyethyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 158709757 |
| Molecular Formula | C36H45ClN2O3 |
| Molecular Weight | 589.22 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 2-benzhydryloxy-N-(2-chloroethyl)-N-methylethanamine;2-[2-benzhydryloxyethyl(methyl)amino]ethanol |
| SMILES | CN(CCCl)CCOC(c1ccccc1)c1ccccc1.CN(CCO)CCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNO.C18H23NO2/c1-20(13-12-19)14-15-21-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-19(12-14-20)13-15-21-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3;2-11,18,20H,12-15H2,1H3 |
| InChIKey | IIOMGCUAOIDYPS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.22 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|