C17H23BrCl2N2O — CID 121230654
N'-[2-[(4-bromophenyl)-phenylmethoxy]ethyl]-N'-methylmethanediamine;dihydrochloride (PubChem CID 121230654) has the molecular formula C17H23BrCl2N2O and a molecular weight of 422.19 g/mol. Its IUPAC name is N'-[2-[(4-bromophenyl)-phenylmethoxy]ethyl]-N'-methylmethanediamine;dihydrochloride.
| Compound Name | N'-[2-[(4-bromophenyl)-phenylmethoxy]ethyl]-N'-methylmethanediamine;dihydrochloride |
|---|---|
| PubChem CID | 121230654 |
| Molecular Formula | C17H23BrCl2N2O |
| Molecular Weight | 422.19 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | N'-[2-[(4-bromophenyl)-phenylmethoxy]ethyl]-N'-methylmethanediamine;dihydrochloride |
| SMILES | CN(CN)CCOC(c1ccccc1)c1ccc(Br)cc1.Cl.Cl |
| InChI | InChI=1S/C17H21BrN2O.2ClH/c1-20(13-19)11-12-21-17(14-5-3-2-4-6-14)15-7-9-16(18)10-8-15;;/h2-10,17H,11-13,19H2,1H3;2*1H |
| InChIKey | IPILLAGNYFQYLD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|