C17H20BrCl2NO — CID 91885114
2-[(4-bromophenyl)-phenylmethoxy]-N-[chloro(dideuterio)methyl]-1-deuterio-N-(trideuteriomethyl)ethanamine;hydrochloride (PubChem CID 91885114) has the molecular formula C17H20BrCl2NO and a molecular weight of 411.20 g/mol. Its IUPAC name is 2-[(4-bromophenyl)-phenylmethoxy]-N-[chloro(dideuterio)methyl]-1-deuterio-N-(trideuteriomethyl)ethanamine;hydrochloride.
| Compound Name | 2-[(4-bromophenyl)-phenylmethoxy]-N-[chloro(dideuterio)methyl]-1-deuterio-N-(trideuteriomethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 91885114 |
| Molecular Formula | C17H20BrCl2NO |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-[(4-bromophenyl)-phenylmethoxy]-N-[chloro(dideuterio)methyl]-1-deuterio-N-(trideuteriomethyl)ethanamine;hydrochloride |
| SMILES | Cl.[2H]C(COC(c1ccccc1)c1ccc(Br)cc1)N(C([2H])([2H])[2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C17H19BrClNO.ClH/c1-20(13-19)11-12-21-17(14-5-3-2-4-6-14)15-7-9-16(18)10-8-15;/h2-10,17H,11-13H2,1H3;1H/i1D3,11D,13D2; |
| InChIKey | CEOOVKJYNXEZRT-PAPSIMHISA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|