C19H25NO2 — CID 129396199
(2R)-3-[3-hydroxypropyl(methyl)amino]-1,1-diphenylpropan-2-ol (PubChem CID 129396199) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2R)-3-[3-hydroxypropyl(methyl)amino]-1,1-diphenylpropan-2-ol.
| Compound Name | (2R)-3-[3-hydroxypropyl(methyl)amino]-1,1-diphenylpropan-2-ol |
|---|---|
| PubChem CID | 129396199 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2R)-3-[3-hydroxypropyl(methyl)amino]-1,1-diphenylpropan-2-ol |
| SMILES | CN(CCCO)C[C@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-20(13-8-14-21)15-18(22)19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18-19,21-22H,8,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | WOGSKGRPHLDNLO-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |