C21H29NO3 — CID 110194014
1-[3-benzhydryloxypropyl(methyl)amino]-3-methoxypropan-2-ol (PubChem CID 110194014) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[3-benzhydryloxypropyl(methyl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[3-benzhydryloxypropyl(methyl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 110194014 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[3-benzhydryloxypropyl(methyl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)CCCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO3/c1-22(16-20(23)17-24-2)14-9-15-25-21(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,20-21,23H,9,14-17H2,1-2H3 |
| InChIKey | KKGQYACUMPBGCF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|