C17H28NO2+ — CID 2184410
[(2S)-butan-2-yl]-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium (PubChem CID 2184410) has the molecular formula C17H28NO2+ and a molecular weight of 278.42 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium.
| Compound Name | [(2S)-butan-2-yl]-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 2184410 |
| Molecular Formula | C17H28NO2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(2S)-butan-2-yl]-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]azanium |
| SMILES | C/C=C/c1ccc(OCCC[NH2+][C@@H](C)CC)c(OC)c1 |
| InChI | InChI=1S/C17H27NO2/c1-5-8-15-9-10-16(17(13-15)19-4)20-12-7-11-18-14(3)6-2/h5,8-10,13-14,18H,6-7,11-12H2,1-4H3/p+1/b8-5+/t14-/m0/s1 |
| InChIKey | WMSMJFIAZKFKEU-GPAKFWEMSA-O |
| XLogP | 2.86 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|