C25H30N2O3 — CID 11304322
5,5-dibenzyl-1-heptyl-1,3-diazinane-2,4,6-trione (PubChem CID 11304322) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5,5-dibenzyl-1-heptyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dibenzyl-1-heptyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11304322 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 5,5-dibenzyl-1-heptyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCN1C(=O)NC(=O)C(Cc2ccccc2)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H30N2O3/c1-2-3-4-5-12-17-27-23(29)25(22(28)26-24(27)30,18-20-13-8-6-9-14-20)19-21-15-10-7-11-16-21/h6-11,13-16H,2-5,12,17-19H2,1H3,(H,26,28,30) |
| InChIKey | RPWIQRQCHAMSDS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|