C31H44N2O2 — CID 150946909
2,2-dibenzyl-3-hexyl-7,7,9,9-tetramethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 150946909) has the molecular formula C31H44N2O2 and a molecular weight of 476.71 g/mol. Its IUPAC name is 2,2-dibenzyl-3-hexyl-7,7,9,9-tetramethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 2,2-dibenzyl-3-hexyl-7,7,9,9-tetramethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 150946909 |
| Molecular Formula | C31H44N2O2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 2,2-dibenzyl-3-hexyl-7,7,9,9-tetramethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | CCCCCCN1C(=O)C2(CC(C)(C)NC(C)(C)C2)OC1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H44N2O2/c1-6-7-8-15-20-33-27(34)30(23-28(2,3)32-29(4,5)24-30)35-31(33,21-25-16-11-9-12-17-25)22-26-18-13-10-14-19-26/h9-14,16-19,32H,6-8,15,20-24H2,1-5H3 |
| InChIKey | LJGHOJHBMNOTKS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|