C20H38N2O2 — CID 151693263
2-ethyl-4-hexyl-2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 151693263) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 2-ethyl-4-hexyl-2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-ethyl-4-hexyl-2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 151693263 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | 2-ethyl-4-hexyl-2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CCCCCCN1C(=O)C(C)(CC)OC12CC(C)(C)NC(C)(C)C2 |
| InChI | InChI=1S/C20H38N2O2/c1-8-10-11-12-13-22-16(23)19(7,9-2)24-20(22)14-17(3,4)21-18(5,6)15-20/h21H,8-15H2,1-7H3 |
| InChIKey | RDAFVSMGURJSRJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|