C22H35ClN2O3 — CID 24836212
[2-(piperidin-1-ylmethyl)cycloheptyl] N-(2-ethoxyphenyl)carbamate;hydrochloride (PubChem CID 24836212) has the molecular formula C22H35ClN2O3 and a molecular weight of 410.99 g/mol. Its IUPAC name is [2-(piperidin-1-ylmethyl)cycloheptyl] N-(2-ethoxyphenyl)carbamate;hydrochloride.
| Compound Name | [2-(piperidin-1-ylmethyl)cycloheptyl] N-(2-ethoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 24836212 |
| Molecular Formula | C22H35ClN2O3 |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [2-(piperidin-1-ylmethyl)cycloheptyl] N-(2-ethoxyphenyl)carbamate;hydrochloride |
| SMILES | CCOc1ccccc1NC(=O)OC1CCCCCC1CN1CCCCC1.Cl |
| InChI | InChI=1S/C22H34N2O3.ClH/c1-2-26-21-14-8-7-12-19(21)23-22(25)27-20-13-6-3-5-11-18(20)17-24-15-9-4-10-16-24;/h7-8,12,14,18,20H,2-6,9-11,13,15-17H2,1H3,(H,23,25);1H |
| InChIKey | PZGWNPRQPOJOEN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |