C24H40N2O3 — CID 53493700
[(1R,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-heptoxyphenyl)carbamate (PubChem CID 53493700) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is [(1R,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-heptoxyphenyl)carbamate.
| Compound Name | [(1R,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 53493700 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | [(1R,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccccc1NC(=O)O[C@@H]1CCCCC[C@@H]1CN(C)C |
| InChI | InChI=1S/C24H40N2O3/c1-4-5-6-7-13-18-28-23-17-12-11-15-21(23)25-24(27)29-22-16-10-8-9-14-20(22)19-26(2)3/h11-12,15,17,20,22H,4-10,13-14,16,18-19H2,1-3H3,(H,25,27)/t20-,22-/m1/s1 |
| InChIKey | IPQHBKLLJZAXIR-IFMALSPDSA-N |
| XLogP | 6.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|