C24H39ClN2O3 — CID 3054992
[(2S,3S)-3-(dimethylamino)-2-bicyclo[2.2.2]octanyl] N-(2-heptoxyphenyl)carbamate;hydrochloride (PubChem CID 3054992) has the molecular formula C24H39ClN2O3 and a molecular weight of 439.04 g/mol. Its IUPAC name is [(2S,3S)-3-(dimethylamino)-2-bicyclo[2.2.2]octanyl] N-(2-heptoxyphenyl)carbamate;hydrochloride.
| Compound Name | [(2S,3S)-3-(dimethylamino)-2-bicyclo[2.2.2]octanyl] N-(2-heptoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 3054992 |
| Molecular Formula | C24H39ClN2O3 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [(2S,3S)-3-(dimethylamino)-2-bicyclo[2.2.2]octanyl] N-(2-heptoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCCCOc1ccccc1NC(=O)O[C@H]1C2CCC(CC2)[C@@H]1N(C)C.Cl |
| InChI | InChI=1S/C24H38N2O3.ClH/c1-4-5-6-7-10-17-28-21-12-9-8-11-20(21)25-24(27)29-23-19-15-13-18(14-16-19)22(23)26(2)3;/h8-9,11-12,18-19,22-23H,4-7,10,13-17H2,1-3H3,(H,25,27);1H/t18?,19?,22-,23-;/m0./s1 |
| InChIKey | KGQJXCQPQOJIQD-MWTULKJHSA-N |
| XLogP | 6.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|