C25H42N2O3 — CID 53493555
[(1S,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-octoxyphenyl)carbamate (PubChem CID 53493555) has the molecular formula C25H42N2O3 and a molecular weight of 418.62 g/mol. Its IUPAC name is [(1S,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-octoxyphenyl)carbamate.
| Compound Name | [(1S,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-octoxyphenyl)carbamate |
|---|---|
| PubChem CID | 53493555 |
| Molecular Formula | C25H42N2O3 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | [(1S,2R)-2-[(dimethylamino)methyl]cycloheptyl] N-(2-octoxyphenyl)carbamate |
| SMILES | CCCCCCCCOc1ccccc1NC(=O)O[C@H]1CCCCC[C@@H]1CN(C)C |
| InChI | InChI=1S/C25H42N2O3/c1-4-5-6-7-8-14-19-29-24-18-13-12-16-22(24)26-25(28)30-23-17-11-9-10-15-21(23)20-27(2)3/h12-13,16,18,21,23H,4-11,14-15,17,19-20H2,1-3H3,(H,26,28)/t21-,23+/m1/s1 |
| InChIKey | SUWIWKNYWHPVRH-GGAORHGYSA-N |
| XLogP | 6.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|