C23H38N2O3 — CID 23277001
[2-[(dimethylamino)methyl]cyclohexyl] N-(2-heptoxyphenyl)carbamate (PubChem CID 23277001) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]cyclohexyl] N-(2-heptoxyphenyl)carbamate.
| Compound Name | [2-[(dimethylamino)methyl]cyclohexyl] N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 23277001 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | [2-[(dimethylamino)methyl]cyclohexyl] N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OC1CCCCC1CN(C)C |
| InChI | InChI=1S/C23H38N2O3/c1-4-5-6-7-12-17-27-22-16-11-9-14-20(22)24-23(26)28-21-15-10-8-13-19(21)18-25(2)3/h9,11,14,16,19,21H,4-8,10,12-13,15,17-18H2,1-3H3,(H,24,26) |
| InChIKey | WFBCKRURDKDICK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|