C27H44N2O3 — CID 124920724
[(1S,2S,3S,4S)-3-(diethylaminomethyl)-5,5-dimethyl-2-bicyclo[2.2.2]octanyl] N-(2-pentoxyphenyl)carbamate (PubChem CID 124920724) has the molecular formula C27H44N2O3 and a molecular weight of 444.66 g/mol. Its IUPAC name is [(1S,2S,3S,4S)-3-(diethylaminomethyl)-5,5-dimethyl-2-bicyclo[2.2.2]octanyl] N-(2-pentoxyphenyl)carbamate.
| Compound Name | [(1S,2S,3S,4S)-3-(diethylaminomethyl)-5,5-dimethyl-2-bicyclo[2.2.2]octanyl] N-(2-pentoxyphenyl)carbamate |
|---|---|
| PubChem CID | 124920724 |
| Molecular Formula | C27H44N2O3 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | [(1S,2S,3S,4S)-3-(diethylaminomethyl)-5,5-dimethyl-2-bicyclo[2.2.2]octanyl] N-(2-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1ccccc1NC(=O)O[C@H]1[C@H]2CC[C@@H]([C@H]1CN(CC)CC)C(C)(C)C2 |
| InChI | InChI=1S/C27H44N2O3/c1-6-9-12-17-31-24-14-11-10-13-23(24)28-26(30)32-25-20-15-16-22(27(4,5)18-20)21(25)19-29(7-2)8-3/h10-11,13-14,20-22,25H,6-9,12,15-19H2,1-5H3,(H,28,30)/t20-,21+,22-,25-/m0/s1 |
| InChIKey | FFYFIZPYPAOCAI-MTQWNXOMSA-N |
| XLogP | 6.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|