C23H39ClN2O3 — CID 53461527
diethyl-[2-[(3-hexoxyphenyl)carbamoyloxy]cyclohexyl]azanium chloride (PubChem CID 53461527) has the molecular formula C23H39ClN2O3 and a molecular weight of 427.03 g/mol. Its IUPAC name is diethyl-[2-[(3-hexoxyphenyl)carbamoyloxy]cyclohexyl]azanium chloride.
| Compound Name | diethyl-[2-[(3-hexoxyphenyl)carbamoyloxy]cyclohexyl]azanium chloride |
|---|---|
| PubChem CID | 53461527 |
| Molecular Formula | C23H39ClN2O3 |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | diethyl-[2-[(3-hexoxyphenyl)carbamoyloxy]cyclohexyl]azanium chloride |
| SMILES | CCCCCCOc1cccc(NC(=O)OC2CCCCC2[NH+](CC)CC)c1.[Cl-] |
| InChI | InChI=1S/C23H38N2O3.ClH/c1-4-7-8-11-17-27-20-14-12-13-19(18-20)24-23(26)28-22-16-10-9-15-21(22)25(5-2)6-3;/h12-14,18,21-22H,4-11,15-17H2,1-3H3,(H,24,26);1H |
| InChIKey | FZVASDVKRPBOHR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|