C23H37ClN2O3 — CID 78169012
(2-pyrrolidin-1-ium-1-ylcyclohexyl) N-(4-hexoxyphenyl)carbamate chloride (PubChem CID 78169012) has the molecular formula C23H37ClN2O3 and a molecular weight of 425.01 g/mol. Its IUPAC name is (2-pyrrolidin-1-ium-1-ylcyclohexyl) N-(4-hexoxyphenyl)carbamate chloride.
| Compound Name | (2-pyrrolidin-1-ium-1-ylcyclohexyl) N-(4-hexoxyphenyl)carbamate chloride |
|---|---|
| PubChem CID | 78169012 |
| Molecular Formula | C23H37ClN2O3 |
| Molecular Weight | 425.01 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (2-pyrrolidin-1-ium-1-ylcyclohexyl) N-(4-hexoxyphenyl)carbamate chloride |
| SMILES | CCCCCCOc1ccc(NC(=O)OC2CCCCC2[NH+]2CCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C23H36N2O3.ClH/c1-2-3-4-9-18-27-20-14-12-19(13-15-20)24-23(26)28-22-11-6-5-10-21(22)25-16-7-8-17-25;/h12-15,21-22H,2-11,16-18H2,1H3,(H,24,26);1H |
| InChIKey | YGNXJBMQFMSIMP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.01 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|