C19H25Cl2N3O2 — CID 87014913
2-[cyclopropyl-[(3,4-dichlorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 87014913) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-[cyclopropyl-[(3,4-dichlorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-[cyclopropyl-[(3,4-dichlorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 87014913 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[cyclopropyl-[(3,4-dichlorophenyl)methyl]amino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)c(Cl)c1)C1CC1)NCCCN1CCCC1=O |
| InChI | InChI=1S/C19H25Cl2N3O2/c20-16-7-4-14(11-17(16)21)12-24(15-5-6-15)13-18(25)22-8-2-10-23-9-1-3-19(23)26/h4,7,11,15H,1-3,5-6,8-10,12-13H2,(H,22,25) |
| InChIKey | CFSXGLQBWYQECK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|