C14H12N6O2 — CID 29494435
N'-(3-aminopyrazine-2-carbonyl)-1H-indole-3-carbohydrazide (PubChem CID 29494435) has the molecular formula C14H12N6O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is N'-(3-aminopyrazine-2-carbonyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(3-aminopyrazine-2-carbonyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 29494435 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N'-(3-aminopyrazine-2-carbonyl)-1H-indole-3-carbohydrazide |
| SMILES | Nc1nccnc1C(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N6O2/c15-12-11(16-5-6-17-12)14(22)20-19-13(21)9-7-18-10-4-2-1-3-8(9)10/h1-7,18H,(H2,15,17)(H,19,21)(H,20,22) |
| InChIKey | HLOHFTQOIWWLJW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|