C19H20N6O2 — CID 38793783
N'-(1-pyrazin-2-ylpiperidine-4-carbonyl)-1H-indole-3-carbohydrazide (PubChem CID 38793783) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N'-(1-pyrazin-2-ylpiperidine-4-carbonyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(1-pyrazin-2-ylpiperidine-4-carbonyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 38793783 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N'-(1-pyrazin-2-ylpiperidine-4-carbonyl)-1H-indole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(c2cnccn2)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N6O2/c26-18(13-5-9-25(10-6-13)17-12-20-7-8-21-17)23-24-19(27)15-11-22-16-4-2-1-3-14(15)16/h1-4,7-8,11-13,22H,5-6,9-10H2,(H,23,26)(H,24,27) |
| InChIKey | ULRZYYWJZDRQKQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|